|
CAS#: 2122-77-2 Product: 2-(2,4,5-Trichlorophenoxy)Ethanol No suppilers available for the product. |
| Name | 2-(2,4,5-Trichlorophenoxy)Ethanol |
|---|---|
| Synonyms | 4-06-00-00964 (Beilstein Handbook Reference); Brn 2051565; Ethanol, 2-(2,4,5-Trichlorophenoxy)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Cl3O2 |
| Molecular Weight | 241.50 |
| CAS Registry Number | 2122-77-2 |
| EINECS | 218-333-7 |
| SMILES | C1=C(OCCO)C(=CC(=C1Cl)Cl)Cl |
| InChI | 1S/C8H7Cl3O2/c9-5-3-7(11)8(4-6(5)10)13-2-1-12/h3-4,12H,1-2H2 |
| InChIKey | ATKFMEGWDYLXBP-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.433°C at 760 mmHg (Cal.) |
| Flash point | 161.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4,5-Trichlorophenoxy)Ethanol |