Online Database of Chemicals from Around the World
|
CAS#: 21247-98-3 Product: Benzo[b]Pyren-6-Ylmethanol No suppilers available for the product. |
| Name | Benzo[b]Pyren-6-Ylmethanol |
|---|---|
| Synonyms | 6-Benzo[B]Pyrenylmethanol; 6-(Hydroxymethyl)Benzo(A)Pyrene; 6-Hydroxymethylbenzo(A)Pyrene |
| Molecular Structure | ![CAS#: 21247-98-3， Benzo[b]Pyren-6-Ylmethanol](/moreStructures/21247-98-3.gif) |
| Molecular Formula | C21H14O |
| Molecular Weight | 282.34 |
| CAS Registry Number | 21247-98-3 |
| SMILES | C1=CC4=C3C2=C1C(=C5C(=C2C=CC3=CC=C4)C=CC=C5)CO |
| InChI | 1S/C21H14O/c22-12-19-16-7-2-1-6-15(16)17-10-8-13-4-3-5-14-9-11-18(19)21(17)20(13)14/h1-11,22H,12H2 |
| InChIKey | FJQLVOHCPDYIFE-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.363°C at 760 mmHg (Cal.) |
| Flash point | 235.868°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo[b]Pyren-6-Ylmethanol |