Online Database of Chemicals from Around the World
| Name | 6-Chlorobenzo[b]Pyrene |
|---|---|
| Synonyms | 6-Chlorobenzeno(A)Pyrene; 6-Chlorobenzo(A)Pyrene; Benzo(A)Pyrene, 6-Chloro- |
| Molecular Structure | ![CAS#: 21248-01-1， 6-Chlorobenzo[b]Pyrene](/moreStructures/21248-01-1.gif) |
| Molecular Formula | C20H11Cl |
| Molecular Weight | 286.76 |
| CAS Registry Number | 21248-01-1 |
| SMILES | C1=CC4=C3C2=C1C5=C(C(=C2C=CC3=CC=C4)Cl)C=CC=C5 |
| InChI | 1S/C20H11Cl/c21-20-16-7-2-1-6-14(16)15-10-8-12-4-3-5-13-9-11-17(20)19(15)18(12)13/h1-11H |
| InChIKey | YBIBTKJSLUJSSJ-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.983°C at 760 mmHg (Cal.) |
| Flash point | 243.728°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chlorobenzo[b]Pyrene |
