Online Database of Chemicals from Around the World
|
CAS#: 2130-67-8 Product: 5-Dehydrosparteine No suppilers available for the product. |
| Name | 5-Dehydrosparteine |
|---|---|
| Synonyms | 5,6-Didehydrosparteine; 5-Dehydrosparteine; 7,14-Methano-2H,6H-Dipyrido(1,2-A:1',2'-E)(1,5)Diazocine, 1,3,4,7,9,10,11,13,14,14A-Decahydro-, (7S-(7Alpha,14Alpha,14Abeta))- |
| Molecular Structure |  |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 |
| CAS Registry Number | 2130-67-8 |
| SMILES | [C@H]13[C@H]4N(C[C@H](C1)C2=CCCCN2C3)CCCC4 |
| InChI | 1S/C15H24N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h5,12-13,15H,1-4,6-11H2/t12-,13-,15-/m0/s1 |
| InChIKey | YIHBNZCJQJSZJP-YDHLFZDLSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.403°C at 760 mmHg (Cal.) |
| Flash point | 166.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Dehydrosparteine |