|
CAS#: 21307-05-1 Product: (6E,22E)-9,10-Secoergosta-5(10),6,8,22-Tetraen-3-Ol No suppilers available for the product. |
| Name | (6E,22E)-9,10-Secoergosta-5(10),6,8,22-Tetraen-3-Ol |
|---|---|
| Synonyms | Previtamin D2; Tachysterol |
| Molecular Structure | ![]() |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.65 |
| CAS Registry Number | 21307-05-1 |
| SMILES | OC3CC(\C=C\C1=C\CCC2(C)C(C(/C=C/C(C)C(C)C)C)CCC12)=C(\C)CC3 |
| InChI | 1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h8-10,12-13,19-20,22,25-27,29H,7,11,14-18H2,1-6H3/b10-9+,13-12+ |
| InChIKey | XQFJZHAVTPYDIQ-OKLKQMLOSA-N |
| Density | 1.021g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.754°C at 760 mmHg (Cal.) |
| Flash point | 218.083°C (Cal.) |
| Refractive index | 1.583 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (6E,22E)-9,10-Secoergosta-5(10),6,8,22-Tetraen-3-Ol |