Online Database of Chemicals from Around the World
| AEchem Scientific Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (630) 364-5106 | |||
 |
info@aechemsc.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Diethyl 2-Benzylsuccinate |
|---|---|
| Synonyms | 2-Benzylsuccinic acid, diethyl ester; Diethyl 2-benzylsuccinate #; Diethyl benzylsuccinate |
| Molecular Structure |  |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 21307-94-8 |
| SMILES | O=C(OCC)CC(C(=O)OCC)Cc1ccccc1 |
| InChI | 1S/C15H20O4/c1-3-18-14(16)11-13(15(17)19-4-2)10-12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3 |
| InChIKey | JZJPBADSXBZWAZ-UHFFFAOYSA-N |
| Density | 1.078g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.369°C at 760 mmHg (Cal.) |
| Flash point | 171.32°C (Cal.) |
| Refractive index | 1.497 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 2-Benzylsuccinate |