| Name | 4-[(2-Amino-4-Oxo-7,8-Dihydro-1H-Pteridin-6-Yl)Methylamino]Benzoic Acid |
|---|---|
| Synonyms | 4-[(2-Amino-4-Keto-7,8-Dihydro-1H-Pteridin-6-Yl)Methylamino]Benzoic Acid; C00921; 7,8-Dihydropteroic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.30 |
| CAS Registry Number | 2134-76-1 |
| SMILES | C1=CC(=CC=C1C(=O)O)NCC3=NC2=C(NC(=NC2=O)N)NC3 |
| InChI | 1S/C14H14N6O3/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23/h1-4,16H,5-6H2,(H,22,23)(H4,15,17,19,20,21) |
| InChIKey | WBFYVDCHGVNRBH-UHFFFAOYSA-N |
| Density | 1.702g/cm3 (Cal.) |
|---|---|
| Boiling point | 597.307°C at 760 mmHg (Cal.) |
| Flash point | 315.04°C (Cal.) |
| (1) | Vitor Mendes, Ana Maranha, Susana Alarico and Nuno Empadinhas. Biosynthesis of mycobacterial methylglucose lipopolysaccharides, Nat. Prod. Rep., 2012, 29, 834. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-[(2-Amino-4-Oxo-7,8-Dihydro-1H-Pteridin-6-Yl)Methylamino]Benzoic Acid |