Online Database of Chemicals from Around the World
|
CAS#: 2135-14-0 Product: Descinolone Acetonide No suppilers available for the product. |
| Name | Descinolone Acetonide |
|---|---|
| Synonyms | C14653; Descinolone Acetonide (Usan); D03691 |
| Molecular Structure |  |
| Molecular Formula | C24H31FO5 |
| Molecular Weight | 418.50 |
| CAS Registry Number | 2135-14-0 |
| EINECS | 218-368-8 |
| SMILES | [C@@]45([C@@]3([C@H]([C@H]2[C@]([C@@]1(C(=CC(=O)C=C1)CC2)C)(F)[C@H](C3)O)C[C@H]4OC(O5)(C)C)C)C(C)=O |
| InChI | 1S/C24H31FO5/c1-13(26)24-19(29-20(2,3)30-24)11-17-16-7-6-14-10-15(27)8-9-21(14,4)23(16,25)18(28)12-22(17,24)5/h8-10,16-19,28H,6-7,11-12H2,1-5H3/t16-,17-,18-,19+,21-,22-,23-,24+/m0/s1 |
| InChIKey | BSHYASCHOGHGHW-PIQRJGQMSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.179°C at 760 mmHg (Cal.) |
| Flash point | 279.281°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Descinolone Acetonide |