Online Database of Chemicals from Around the World
| Amadis Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8992-5085 | |||
 |
sales@amadischem.com | |||
 |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink standard supplier since 2016 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Methyl 3-Chloro-4-Isopropoxybenzoate |
|---|---|
| Synonyms | methyl 3-chloro-4-isopropoxybenzoate |
| Molecular Structure |  |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 |
| CAS Registry Number | 213598-06-2 |
| SMILES | Clc1cc(ccc1OC(C)C)C(=O)OC |
| InChI | 1S/C11H13ClO3/c1-7(2)15-10-5-4-8(6-9(10)12)11(13)14-3/h4-7H,1-3H3 |
| InChIKey | UXAJQOWYJGUDCQ-UHFFFAOYSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.82°C at 760 mmHg (Cal.) |
| Flash point | 125.712°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-Chloro-4-Isopropoxybenzoate |