| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 1-Chloro-3-(Trichloromethyl)-Benzene |
|---|---|
| Synonyms | Benzene, 1-Chloro-3-(Trichloromethyl)-; Nsc59737; Toluene, M,.Alpha.,.Alpha.,.Alpha.-Tetrachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4Cl4 |
| Molecular Weight | 229.92 |
| CAS Registry Number | 2136-81-4 |
| EINECS | 218-376-1 |
| SMILES | C1=C(C=CC=C1Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C7H4Cl4/c8-6-3-1-2-5(4-6)7(9,10)11/h1-4H |
| InChIKey | ZVPXXRHACIEOFJ-UHFFFAOYSA-N |
| Density | 1.506g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.999°C at 760 mmHg (Cal.) |
| Flash point | 101.853°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-3-(Trichloromethyl)-Benzene |