|
CAS#: 21416-14-8 Product: Pancracine No suppilers available for the product. |
| Name | Pancracine |
|---|---|
| Synonyms | pancracine; C12186; CHEBI:31958 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 |
| CAS Registry Number | 21416-14-8 |
| SMILES | O1c2c(OC1)cc3c(c2)[C@H]4C/5=C/[C@H](O)[C@@H](O)C[C@@H]\5N(C3)C4 |
| InChI | 1S/C16H17NO4/c18-13-2-10-11-6-17(12(10)4-14(13)19)5-8-1-15-16(3-9(8)11)21-7-20-15/h1-3,11-14,18-19H,4-7H2/t11-,12-,13-,14-/m0/s1 |
| InChIKey | JKZMYBLUKAMPKM-XUXIUFHCSA-N |
| Density | 1.537g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.913°C at 760 mmHg (Cal.) |
| Flash point | 249.486°C (Cal.) |
| Refractive index | 1.733 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pancracine |