Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Oakwood Products, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (800) 467-3386 | |||
|
k_weaver@oakwoodchemical.com | |||
| Chemical manufacturer | ||||
| Name | {[(2-Methylphenyl)Sulfanyl](Methylsulfanyl)Methylene}Malononitrile |
|---|---|
| Synonyms | 2-[(2-methylphenylthio)(methylthio)methylene]-; 2-[(2-methylphenylthio)(methylthio)methylene]-malononitrile; Malononitrile |
| Molecular Structure | Methylene}Malononitrile](/moreStructures/214330-80-0.gif) |
| Molecular Formula | C12H10N2S2 |
| Molecular Weight | 246.35 |
| CAS Registry Number | 214330-80-0 |
| SMILES | N#C/C(C#N)=C(/SC)Sc1ccccc1C |
| InChI | 1S/C12H10N2S2/c1-9-5-3-4-6-11(9)16-12(15-2)10(7-13)8-14/h3-6H,1-2H3 |
| InChIKey | CZWGAWFKACRSRA-UHFFFAOYSA-N |
| Density | 1.15-1.35 (Expl.) |
|---|---|
| 1.251g/cm3 (Cal.) | |
| Boiling point | 348.342°C at 760 mmHg (Cal.) |
| Flash point | 164.472°C (Cal.) |
| Refractive index | 1.627 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for {[(2-Methylphenyl)Sulfanyl](Methylsulfanyl)Methylene}Malononitrile |