Online Database of Chemicals from Around the World
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (845) 299-6009/ | |||
 |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Dimethyl 3-Methylphthalate |
|---|---|
| Synonyms | Dimethyl 3-methylphthalate |
| Molecular Structure |  |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 21483-46-5 |
| SMILES | O=C(OC)c1c(cccc1C)C(=O)OC |
| InChI | 1S/C11H12O4/c1-7-5-4-6-8(10(12)14-2)9(7)11(13)15-3/h4-6H,1-3H3 |
| InChIKey | CSYOORDPNRFQTI-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.167°C at 760 mmHg (Cal.) |
| Flash point | 121.766°C (Cal.) |
| Refractive index | 1.513 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 3-Methylphthalate |