Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3R)-3-Amino-4-Indanol |
|---|---|
| Synonyms | (R)-3-amino-2,3-dihydro-1H-inden-4-ol |
| Molecular Structure |  |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 |
| CAS Registry Number | 215362-46-2 |
| SMILES | c1cc2c(c(c1)O)[C@@H](CC2)N |
| InChI | 1S/C9H11NO/c10-7-5-4-6-2-1-3-8(11)9(6)7/h1-3,7,11H,4-5,10H2/t7-/m1/s1 |
| InChIKey | MAYMVHAVYDCEHG-SSDOTTSWSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.043°C at 760 mmHg (Cal.) |
| Flash point | 90.508°C (Cal.) |
| Refractive index | 1.622 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-3-Amino-4-Indanol |