Online Database of Chemicals from Around the World
|
CAS#: 21550-10-7 Product: (1R,2R)-1-Hydroxy-1-Phenyl-3-Buten-2-Yl Acetate No suppilers available for the product. |
| Name | (1R,2R)-1-Hydroxy-1-Phenyl-3-Buten-2-Yl Acetate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 21550-10-7 |
| SMILES | O=C(O[C@H](\C=C)[C@H](O)c1ccccc1)C |
| InChI | 1S/C12H14O3/c1-3-11(15-9(2)13)12(14)10-7-5-4-6-8-10/h3-8,11-12,14H,1H2,2H3/t11-,12-/m1/s1 |
| InChIKey | AKRQNQWVQGXCDB-VXGBXAGGSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.436°C at 760 mmHg (Cal.) |
| Flash point | 135.659°C (Cal.) |
| Refractive index | 1.53 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-1-Hydroxy-1-Phenyl-3-Buten-2-Yl Acetate |