Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-Nitro-3-Pyridinyl Carbonate |
|---|---|
| Synonyms | methyl (2-nitropyridin-3-yl) carbonate |
| Molecular Structure |  |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13 |
| CAS Registry Number | 21620-05-3 |
| SMILES | COC(=O)Oc1cccnc1[N+](=O)[O-] |
| InChI | 1S/C7H6N2O5/c1-13-7(10)14-5-3-2-4-8-6(5)9(11)12/h2-4H,1H3 |
| InChIKey | PPTYTAHMWXEWNY-UHFFFAOYSA-N |
| Density | 1.431g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.567°C at 760 mmHg (Cal.) |
| Flash point | 175.493°C (Cal.) |
| Refractive index | 1.548 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Nitro-3-Pyridinyl Carbonate |