Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(1-Methylethyl)-Phenol Carbonate (2:1) |
|---|---|
| Synonyms | Bis(4-Isopropylphenyl) Carbonate; Carbonic Acid Bis(4-Isopropylphenyl) Ester; Nsc47192 |
| Molecular Structure |  |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 |
| CAS Registry Number | 2167-55-7 |
| SMILES | C1=CC(=CC=C1OC(=O)OC2=CC=C(C=C2)C(C)C)C(C)C |
| InChI | 1S/C19H22O3/c1-13(2)15-5-9-17(10-6-15)21-19(20)22-18-11-7-16(8-12-18)14(3)4/h5-14H,1-4H3 |
| InChIKey | FAMYXRBOUQOMGA-UHFFFAOYSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.215°C at 760 mmHg (Cal.) |
| Flash point | 120.536°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1-Methylethyl)-Phenol Carbonate (2:1) |