|
CAS#: 21683-86-3 Product: 3-(1-Benzofuran-2-Yl)Propanoic Acid No suppilers available for the product. |
| Name | 3-(1-Benzofuran-2-Yl)Propanoic Acid |
|---|---|
| Synonyms | 3-(Benzofuran-2-Yl)Propanoate; 3-(2-Benzofuranyl)Propanoate; 3-(Benzofuran-2-Yl)Propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9O3 |
| Molecular Weight | 189.19 |
| CAS Registry Number | 21683-86-3 |
| SMILES | C1=C(OC2=CC=CC=C12)CCC([O-])=O |
| InChI | 1S/C11H10O3/c12-11(13)6-5-9-7-8-3-1-2-4-10(8)14-9/h1-4,7H,5-6H2,(H,12,13)/p-1 |
| InChIKey | RSCSQNQHINMHDE-UHFFFAOYSA-M |
| Boiling point | 341.153°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 160.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1-Benzofuran-2-Yl)Propanoic Acid |