Online Database of Chemicals from Around the World
|
CAS#: 216879-03-7 Product: (1R,2S)-2-Hydroxycyclopentanecarbohydrazide No suppilers available for the product. |
| Name | (1R,2S)-2-Hydroxycyclopentanecarbohydrazide |
|---|---|
| Synonyms | (1R,2S)-2-hydroxycyclopentanecarbohydrazide |
| Molecular Structure |  |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 |
| CAS Registry Number | 216879-03-7 |
| SMILES | O=C(NN)[C@@H]1CCC[C@@H]1O |
| InChI | 1S/C6H12N2O2/c7-8-6(10)4-2-1-3-5(4)9/h4-5,9H,1-3,7H2,(H,8,10)/t4-,5+/m1/s1 |
| InChIKey | WJADOCJMCWWZQH-UHNVWZDZSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.679°C at 760 mmHg (Cal.) |
| Flash point | 181.004°C (Cal.) |
| Refractive index | 1.557 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-Hydroxycyclopentanecarbohydrazide |