Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Merck Millipore | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (10) 5989-8600 | |||
|
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Name | Tert-Butyl L-Alaninate |
|---|---|
| Synonyms | (2S)-2-Aminopropanoic Acid Tert-Butyl Ester; (2S)-2-Aminopropionic Acid Tert-Butyl Ester |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 |
| CAS Registry Number | 21691-50-9 |
| EINECS | 244-532-3 |
| SMILES | [C@H](C(OC(C)(C)C)=O)(N)C |
| InChI | 1S/C7H15NO2/c1-5(8)6(9)10-7(2,3)4/h5H,8H2,1-4H3/t5-/m0/s1 |
| InChIKey | TZHVYFBSLOMRCU-YFKPBYRVSA-N |
| Density | 0.957g/cm3 (Cal.) |
|---|---|
| Boiling point | 163.099°C at 760 mmHg (Cal.) |
| Flash point | 37.035°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl L-Alaninate |