| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink standard supplier since 2018 | ||||
| Crescent Chemical Co. Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Pesticides, veterinary drugs and fertilizers |
|---|---|
| Name | 3-(4-Isopropylphenyl)-1,1-Bis[(2H3)Methyl]Urea |
| Synonyms | 3-(4-Isopropylphenyl)-1,1-dimethylurea-d6; Isoproturon-d6; 34017_RIEDEL |
| Molecular Formula | C12H12D6N2O |
| Molecular Weight | 212.32 |
| CAS Registry Number | 217487-17-7 |
| SMILES | O=C(Nc1ccc(cc1)C(C)C)N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | 1S/C12H18N2O/c1-9(2)10-5-7-11(8-6-10)13-12(15)14(3)4/h5-9H,1-4H3,(H,13,15)/i3D3,4D3 |
| InChIKey | PUIYMUZLKQOUOZ-LIJFRPJRSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.194°C at 760 mmHg (Cal.) |
| Flash point | 167.406°C (Cal.) |
| Refractive index | 1.555 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Isopropylphenyl)-1,1-Bis[(2H3)Methyl]Urea |