| Sinbond Industrial Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.sinbondpharm.com | |||
![]() | +86 (531) 8703-8285 +86 13583181986 +44 (208) 242-5518 | |||
![]() | +86 (531) 8703-8285 | |||
![]() | cici1124@gmail.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2014 | ||||
| Name | 3,3',5,5'-Tetraisopropyldiphenoquinone |
|---|---|
| Synonyms | 4-[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-one |
| Molecular Structure | ![]() |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.51 |
| CAS Registry Number | 2178-51-0 |
| EC Number | 670-239-9 |
| SMILES | CC(C)C1=CC(=C2C=C(C(=O)C(=C2)C(C)C)C(C)C)C=C(C1=O)C(C)C |
| Solubility | 0.003168 mg/L (25 °C water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.538, Calc.* |
| Melting point | 166.34 °C |
| Boiling Point | 437.01 °C, 461.2±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 171.6±25.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H312-H315-H319-H335-H410 Details | ||||||||||||||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P270-P271-P273-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P317-P319-P321-P330-P332+P317-P337+P317-P362+P364-P391-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 3,3',5,5'-Tetraisopropyldiphenoquinone |