| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() | www.hoffmanchemicals.com | |||
![]() | +61 3-7003-5401 | |||
![]() | info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2023 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Biphenyl compounds |
|---|---|
| Name | 4'-Bromo-[1,1'-biphenyl]-2-ol |
| Synonyms | 2-(4-Bromophenyl)phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9BrO |
| Molecular Weight | 249.10 |
| CAS Registry Number | 21849-89-8 |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)O |
| Solubility | 25.14 mg/L (25 °C water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.632, Calc.* |
| Melting point | 115.33 °C |
| Boiling Point | 350.27 °C, 343.5±17.0 °C (760 mmHg), Calc.* |
| Flash Point | 161.6±20.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4'-Bromo-[1,1'-biphenyl]-2-ol |