Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Chloro-N-[2-(2,4-Dichlorophenoxy)Phenyl]Acetamide |
|---|---|
| Synonyms | ACETAMIDE,2-CHLORO-N-[2-(2,4-DICHLOROPHENOXY)PHENYL]-; N1-[2-(2,4-dichlorophenoxy)phenyl]-2-chloroacetamide; ZINC00152827 |
| Molecular Structure | ![CAS#: 219314-77-9， 2-Chloro-N-[2-(2,4-Dichlorophenoxy)Phenyl]Acetamide](/moreStructures/219314-77-9.gif) |
| Molecular Formula | C14H10Cl3NO2 |
| Molecular Weight | 330.59 |
| CAS Registry Number | 219314-77-9 |
| SMILES | Clc2cc(Cl)ccc2Oc1ccccc1NC(=O)CCl |
| InChI | 1S/C14H10Cl3NO2/c15-8-14(19)18-11-3-1-2-4-13(11)20-12-6-5-9(16)7-10(12)17/h1-7H,8H2,(H,18,19) |
| InChIKey | KWZVXDMJPLZPKS-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.187°C at 760 mmHg (Cal.) |
| Flash point | 226.67°C (Cal.) |
| Refractive index | 1.633 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-N-[2-(2,4-Dichlorophenoxy)Phenyl]Acetamide |