Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| C D N Isotopes Inc. | Canada | Inquire | ||
|---|---|---|---|---|
|
+1 (800) 565-4696 / (514) 697-6254 | |||
|
info@cdnisotopes.com, | |||
| Chemical manufacturer since 1993 | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (386) 462-0788 | |||
|
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 1-(2H5)Phenyl(2H4)Ethan(2H)Ol |
|---|---|
| Synonyms | (±)-1-Phenylethanol-d10; 1-Phenylethanol-D10 >99.0 Atom % D |
| Molecular Structure |  |
| Molecular Formula | C8D10O |
| Molecular Weight | 132.23 |
| CAS Registry Number | 219586-41-1 |
| SMILES | [2H]c1c(c(c(c(c1[2H])[2H])C([2H])(C([2H])([2H])[2H])O[2H])[2H])[2H] |
| InChI | 1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3/i1D3,2D,3D,4D,5D,6D,7D,9D |
| InChIKey | WAPNOHKVXSQRPX-NGOYZNFYSA-N |
| Density | 1.094 (Expl.) |
|---|---|
| 1.097g/cm3 (Cal.) | |
| Melting point | 19-20°C (Expl.) |
| Boiling point | 206.917°C at 760 mmHg (Cal.) |
| 204°C (Expl.) | |
| Flash point | 86°C (Expl.) |
| 91.171°C (Cal.) | |
| Refractive index | 1.532 (Cal.) |
| Safety Description | Harmful/Hygroscopic/Moisture Sensitive/Store under Argon |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2H5)Phenyl(2H4)Ethan(2H)Ol |