Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-[Amino(Carboxy)Methyl]Benzoic Acid |
|---|---|
| Synonyms | 3-(Amino-carboxy-methyl)-benzoic acid; ammonio(3-carboxyphenyl)acetate |
| Molecular Structure | ![CAS#: 2196-57-8， 3-[Amino(Carboxy)Methyl]Benzoic Acid](/moreStructures/2196-57-8.gif) |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 |
| CAS Registry Number | 2196-57-8 |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(C(=O)O)N |
| InChI | 1S/C9H9NO4/c10-7(9(13)14)5-2-1-3-6(4-5)8(11)12/h1-4,7H,10H2,(H,11,12)(H,13,14) |
| InChIKey | REEQCKHBOMHDKN-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.9±40.0°C at 760 mmHg (Cal.) |
| Flash point | 215.0±27.3°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-[Amino(Carboxy)Methyl]Benzoic Acid |