Online Database of Chemicals from Around the World
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+86 (21) 6141-5566 / 800-819-3336 | |||
 |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | N-(2H3)Methyl(2H3)Methan(2H)Amine |
|---|---|
| Synonyms | Dimethylamine-d7; 587974_ALDRICH |
| Molecular Structure |  |
| Molecular Formula | C2D7N |
| Molecular Weight | 52.13 |
| CAS Registry Number | 22024-52-8 |
| SMILES | [2H]C([2H])([2H])N([2H])C([2H])([2H])[2H] |
| InChI | 1S/C2H7N/c1-3-2/h3H,1-2H3/i1D3,2D3/hD |
| InChIKey | ROSDSFDQCJNGOL-KBKLHOFPSA-N |
| Density | 0.74g/cm3 (Cal.) |
|---|---|
| Boiling point | 6.1°C at 760 mmHg (Cal.) |
| Refractive index | 1.344 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2H3)Methyl(2H3)Methan(2H)Amine |