|
CAS#: 22034-63-5 Product: Estradiol 3-Propyl Ether No suppilers available for the product. |
| Name | Estradiol 3-Propyl Ether |
|---|---|
| Synonyms | 3-Propoxyestra-1,3,5(10)-Trien-17Beta-Ol; Estradiol 3-Propyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 22034-63-5 |
| SMILES | [C@@H]23C1=CC=C(C=C1CC[C@H]2[C@H]4[C@](CC3)([C@H](CC4)O)C)OCCC |
| InChI | 1S/C21H30O2/c1-3-12-23-15-5-7-16-14(13-15)4-6-18-17(16)10-11-21(2)19(18)8-9-20(21)22/h5,7,13,17-20,22H,3-4,6,8-12H2,1-2H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | OKWLCMYNQNHQSR-MJCUULBUSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.482°C at 760 mmHg (Cal.) |
| Flash point | 195.867°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Estradiol 3-Propyl Ether |