Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Tert-Butylbenzene-1,3-Diol |
|---|---|
| Synonyms | 4-Tert-Butylresorcinol; Resorcinol, 4-Tert-Butyl-; 4-Tert-Butyl-Resorcinol |
| Molecular Structure |  |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| CAS Registry Number | 2206-50-0 |
| SMILES | C1=CC(=CC(=C1C(C)(C)C)O)O |
| InChI | 1S/C10H14O2/c1-10(2,3)8-5-4-7(11)6-9(8)12/h4-6,11-12H,1-3H3 |
| InChIKey | YBKODUYVZRLSOK-UHFFFAOYSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.738°C at 760 mmHg (Cal.) |
| Flash point | 133.919°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Tert-Butylbenzene-1,3-Diol |