Online Database of Chemicals from Around the World
| Name | 1-Phenylethenyl Acetate |
|---|---|
| Synonyms | 1-Phenylvinyl Acetate; Acetic Acid 1-Phenylvinyl Ester; 1-Phenylethenyl Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 |
| CAS Registry Number | 2206-94-2 |
| EINECS | 218-620-7 |
| SMILES | C1=CC=C(C=C1)C(OC(=O)C)=C |
| InChI | 1S/C10H10O2/c1-8(12-9(2)11)10-6-4-3-5-7-10/h3-7H,1H2,2H3 |
| InChIKey | HWCUCNKPBMGSSC-UHFFFAOYSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.568°C at 760 mmHg (Cal.) |
| Flash point | 83.987°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenylethenyl Acetate |
