Online Database of Chemicals from Around the World
6-Methyl-2,4-dioxo-N'-5'-(4-pyridylcarbonyl)-1,2,3,4-tetrahydro-5-pyrimidinesulfonohydrazid
[CAS# 220654-99-9]
Identification| Name | 6-Methyl-2,4-dioxo-N'-5'-(4-pyridylcarbonyl)-1,2,3,4-tetrahydro-5-pyrimidinesulfonohydrazid |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C11H13N5O5S |
| Molecular Weight | 327.32 |
| CAS Registry Number | 220654-99-9 |
| EC Number | 606-923-0 |
| SMILES | CC1C(C(=O)NC(=O)N1)S(=O)(=O)NNC(=O)C2=CC=NC=C2 |
|
Properties
| Solubility | 373.4 mg/L (25 °C water) |
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.669, Calc.* |
| Melting point | 295.81 °C |
| Boiling point | 678.13 °C |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS07 Warning Details |
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Specific target organ toxicity - single exposure | STOT SE | 3 | H335 |
| Skin irritation | Skin Irrit. | 2 | H315 |
| Acute toxicity | Acute Tox. | 4 | H302 |
| Eye irritation | Eye Irrit. | 2A | H319 |
|
| SDS | Available |
|
Related Products
(5Z)-4-Methyl-2... [(7R)-7-Methyl-... 1-Methyl-2,5-Di... a1-methyl-2,5-d... (7-Methyl-2,6-D... (8-Methyl-2,6-D... N-[(Z)-(6-Methy... N-[(Z)-(6-Methy... N-[(6-Methyl-2,... Methyl 2,4-Diox... [(2S,5R)-5-(5-M... (E)-3-(4-Methyl... 3-(5-Methyl-2,6... (2S)-2-[2-(5-Me... 1-Methyl-2,5-di... Methyl 2,4-Diox... 2-Methyl-3,5-di... Methyl (2,4-dio... Methyl (2S)-2-[... Methyl 3-(2,5-d...