Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Amino[1,2,5]Thiadiazolo[3,4-b]Pyrazine-5(3H)-Thione |
|---|---|
| Synonyms | 6-amino-[1,2,5]thiadiazolo[3,4-b]pyrazine-5(3H)-thione |
| Molecular Structure | ![CAS#: 220877-57-6， 6-Amino[1,2,5]Thiadiazolo[3,4-b]Pyrazine-5(3H)-Thione](/moreStructures/220877-57-6.gif) |
| Molecular Formula | C4H3N5S2 |
| Molecular Weight | 185.23 |
| CAS Registry Number | 220877-57-6 |
| SMILES | c1(c(=S)[nH]c2c(n1)nsn2)N |
| InChI | 1S/C4H3N5S2/c5-1-4(10)7-3-2(6-1)8-11-9-3/h(H2,5,6,8)(H,7,9,10) |
| InChIKey | SBNOEVQWEROACT-UHFFFAOYSA-N |
| Density | 2.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.444°C at 760 mmHg (Cal.) |
| Flash point | 195.377°C (Cal.) |
| Refractive index | 2.246 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino[1,2,5]Thiadiazolo[3,4-b]Pyrazine-5(3H)-Thione |