Online Database of Chemicals from Around the World
| Name | 2-[(5-Amino-2-Methoxyphenyl)Sulfonyl]Ethanol |
|---|---|
| Molecular Structure | ![CAS#: 22094-96-8， 2-[(5-Amino-2-Methoxyphenyl)Sulfonyl]Ethanol](/moreStructures/22094-96-8.gif) |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 |
| CAS Registry Number | 22094-96-8 |
| SMILES | O=S(=O)(c1cc(ccc1OC)N)CCO |
| InChI | 1S/C9H13NO4S/c1-14-8-3-2-7(10)6-9(8)15(12,13)5-4-11/h2-3,6,11H,4-5,10H2,1H3 |
| InChIKey | PPZPNXZSZRZLJY-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.878°C at 760 mmHg (Cal.) |
| Flash point | 270.027°C (Cal.) |
| Refractive index | 1.57 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(5-Amino-2-Methoxyphenyl)Sulfonyl]Ethanol |
