|
CAS#: 221031-08-9 Product: 4,5-Dibromo-2-(3,4-Difluorophenyl)-3(2H)-Pyridazinone No suppilers available for the product. |
| Name | 4,5-Dibromo-2-(3,4-Difluorophenyl)-3(2H)-Pyridazinone |
|---|---|
| Synonyms | 4,5-dibromo-2-(3,4-difluorophenyl)-3(2H)-Pyridazinone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H4Br2F2N2O |
| Molecular Weight | 365.96 |
| CAS Registry Number | 221031-08-9 |
| SMILES | Fc1ccc(cc1F)N2\N=CC(\Br)=C(\Br)C2=O |
| InChI | 1S/C10H4Br2F2N2O/c11-6-4-15-16(10(17)9(6)12)5-1-2-7(13)8(14)3-5/h1-4H |
| InChIKey | RIDNCXXOUTWXDM-UHFFFAOYSA-N |
| Density | 2.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.662°C at 760 mmHg (Cal.) |
| Flash point | 177.366°C (Cal.) |
| Refractive index | 1.656 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dibromo-2-(3,4-Difluorophenyl)-3(2H)-Pyridazinone |