| Maanshan Tiantai Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.tiantaibio-tech.cn | |||
![]() | +86 (0555) 888-9890 | |||
![]() | +86 (0555) 888-9890 | |||
![]() | shenguangguang@tiantaibio-tech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2013 | ||||
| chemBlink Standard supplier since 2022 | ||||
| Name | 2-O-(alpha-D-glucopyranosyl)glycerol |
|---|---|
| Synonyms | (2S,3R,4S,5S,6R)-2-(1,3-dihydroxypropan-2-yloxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18O8 |
| Molecular Weight | 254.23 |
| CAS Registry Number | 22160-26-5 |
| EC Number | 824-773-6 |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC(CO)CO)O)O)O)O |
| Solubility | 1 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.592, Calc.* |
| Melting point | 189.00 °C |
| Boiling Point | 467.76 °C, 606.1±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 320.4±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-O-(alpha-D-glucopyranosyl)glycerol |