Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-(3,4-Dihydroxyphenyl)-2-Fluoropropanoic Acid |
|---|---|
| Synonyms | 3-(3,4-dihydroxyphenyl)-2-fluoropropanoic acid |
| Molecular Structure |  |
| Molecular Formula | C9H9FO4 |
| Molecular Weight | 200.16 |
| CAS Registry Number | 22179-94-8 |
| SMILES | c1cc(c(cc1CC(C(=O)O)F)O)O |
| InChI | 1S/C9H9FO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3H2,(H,13,14) |
| InChIKey | DBQVBSXCICUQIM-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.094°C at 760 mmHg (Cal.) |
| Flash point | 209.68°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,4-Dihydroxyphenyl)-2-Fluoropropanoic Acid |