|
CAS#: 22230-46-2 Product: 1,2,3,4,5-Pentabromo-6-Nitrobenzene No suppilers available for the product. |
| Name | 1,2,3,4,5-Pentabromo-6-Nitrobenzene |
|---|---|
| Synonyms | 2,3,4,5,6-PENTABROMONITROBENZENE |
| Molecular Structure | ![]() |
| Molecular Formula | C6Br5NO2 |
| Molecular Weight | 517.59 |
| CAS Registry Number | 22230-46-2 |
| SMILES | Brc1c(c(Br)c(Br)c(Br)c1Br)[N+]([O-])=O |
| InChI | 1S/C6Br5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 |
| InChIKey | UBXJDBZRIYWPEF-UHFFFAOYSA-N |
| Density | 2.841g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.728°C at 760 mmHg (Cal.) |
| Flash point | 174.986°C (Cal.) |
| Refractive index | 1.711 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentabromo-6-Nitrobenzene |