| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | S,S-Dimethyl-N-(p-Toluenesulfonyl)Sulfoximine |
|---|---|
| Synonyms | Dimethyl N-(P-Toluenesulfonyl)Sulfoximine; Dimethyl-N-(4-Toluenesulfonyl)Sulfoximine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13NO3S2 |
| Molecular Weight | 247.33 |
| CAS Registry Number | 22236-45-9 |
| EINECS | 244-861-2 |
| SMILES | C1=C([S](N=[S](C)(C)=O)(=O)=O)C=CC(=C1)C |
| InChI | 1S/C9H13NO3S2/c1-8-4-6-9(7-5-8)15(12,13)10-14(2,3)11/h4-7H,1-3H3 |
| InChIKey | IRNAWARRPQUZDU-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 167-169°C (Expl.) |
| Boiling point | 390.8±35.0°C at 760 mmHg (Cal.) |
| Flash point | 190.1±25.9°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for S,S-Dimethyl-N-(p-Toluenesulfonyl)Sulfoximine |