|
CAS#: 22243-41-0 Product: N,N,1,7,7-Pentamethylbicyclo[2.2.1]Heptan-2-Amine No suppilers available for the product. |
| Name | N,N,1,7,7-Pentamethylbicyclo[2.2.1]Heptan-2-Amine |
|---|---|
| Synonyms | (±)Dimethyl-(1,7,7-trimethyl-bicyclo[2.2.1]hept-2-yl)-amine; 2-Bornanamine, N,N-dimethyl-, endo-; bicyclo[2.2.1]heptan-2-amine, N,N,1,7,7-pentamethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 |
| CAS Registry Number | 22243-41-0 |
| SMILES | CC1(C2CCC1(C(C2)N(C)C)C)C |
| InChI | 1S/C12H23N/c1-11(2)9-6-7-12(11,3)10(8-9)13(4)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | XUDICDUSDBRTAJ-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 204.0±8.0°C at 760 mmHg (Cal.) |
| Flash point | 69.5±15.3°C (Cal.) |
| Refractive index | 1.491 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,1,7,7-Pentamethylbicyclo[2.2.1]Heptan-2-Amine |