Online Database of Chemicals from Around the World
|
CAS#: 22243-89-6 Product: 3,5-Dichloro-2-Hydroxybenzenesulfonyl Fluoride No suppilers available for the product. |
| Name | 3,5-Dichloro-2-Hydroxybenzenesulfonyl Fluoride |
|---|---|
| Synonyms | 3,5-Dichloro-2-Hydroxy-Benzenesulfonyl Fluoride; Brn 2845429; Nsc 196174 |
| Molecular Structure |  |
| Molecular Formula | C6H3Cl2FO3S |
| Molecular Weight | 245.05 |
| CAS Registry Number | 22243-89-6 |
| SMILES | C1=C([S](=O)(=O)F)C(=C(C=C1Cl)Cl)O |
| InChI | 1S/C6H3Cl2FO3S/c7-3-1-4(8)6(10)5(2-3)13(9,11)12/h1-2,10H |
| InChIKey | ZLIQQQUQVHJBOH-UHFFFAOYSA-N |
| Density | 1.72g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.696°C at 760 mmHg (Cal.) |
| Flash point | 145.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-2-Hydroxybenzenesulfonyl Fluoride |