| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 2-Isopropyl-5-Methylcyclohexyl Methacrylate |
|---|---|
| Synonyms | (-)-menthyl methacrylate; (−)-menthyl methacrylate; 2-Isopropyl-5-methylcyclohexyl 2-methylacrylate # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 |
| CAS Registry Number | 2231-91-6 |
| SMILES | O=C(OC1CC(CCC1C(C)C)C)\C(=C)C |
| InChI | 1S/C14H24O2/c1-9(2)12-7-6-11(5)8-13(12)16-14(15)10(3)4/h9,11-13H,3,6-8H2,1-2,4-5H3 |
| InChIKey | VYPRXWXGLLURNB-UHFFFAOYSA-N |
| Density | 0.928g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.207°C at 760 mmHg (Cal.) |
| Flash point | 111.006°C (Cal.) |
| Refractive index | 1.459 (Cal.) |
| (1) | Eun Hee Min, Kok Hou Wong, Eki Setijadi, François Ladouceur, Mark Straton and Alexander Argyros. Menthol-based chiral copolymers for polymer optical fibres (POF), Polym. Chem., 2011, 2, 2045. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-5-Methylcyclohexyl Methacrylate |