Online Database of Chemicals from Around the World
|
CAS#: 22327-77-1 Product: Sporidesmin E No suppilers available for the product. |
| Name | Sporidesmin E |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C18H20ClN3O6S3 |
| Molecular Weight | 506.01 |
| CAS Registry Number | 22327-77-1 |
| SMILES | C1=C(Cl)C(=C(C3=C1C2(C(C45N(C2N3C)C(=O)C(N(C4=O)C)(C)SSS5)O)O)OC)OC |
| InChI | 1S/C18H20ClN3O6S3/c1-16-14(24)22-13-17(26,12(23)18(22,30-31-29-16)15(25)21(16)3)7-6-8(19)10(27-4)11(28-5)9(7)20(13)2/h6,12-13,23,26H,1-5H3 |
| InChIKey | NAEONKBZNXPTMI-UHFFFAOYSA-N |
| Density | 1.777g/cm3 (Cal.) |
|---|---|
| Boiling point | 805.438°C at 760 mmHg (Cal.) |
| Flash point | 440.913°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sporidesmin E |