Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-[4-(2-Amino-4-Fluorophenyl)-1-Piperazinyl]Ethanone |
|---|---|
| Synonyms | 2-(4-Acetyl-piperazin-1-yl)-5-fluoroaniline; ETHANONE,1-[4-(2-AMINO-4-FLUOROPHENYL)-1-PIPERAZINYL]- |
| Molecular Structure | ![CAS#: 223513-02-8， 1-[4-(2-Amino-4-Fluorophenyl)-1-Piperazinyl]Ethanone](/moreStructures/223513-02-8.gif) |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.27 |
| CAS Registry Number | 223513-02-8 |
| SMILES | CC(=O)N1CCN(CC1)c2ccc(F)cc2N |
| InChI | 1S/C12H16FN3O/c1-9(17)15-4-6-16(7-5-15)12-3-2-10(13)8-11(12)14/h2-3,8H,4-7,14H2,1H3 |
| InChIKey | OECCVDNJKOKUMN-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.911°C at 760 mmHg (Cal.) |
| Flash point | 222.875°C (Cal.) |
| Refractive index | 1.58 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(2-Amino-4-Fluorophenyl)-1-Piperazinyl]Ethanone |