| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Livchem Logistics GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (69) 3800-2330 | |||
![]() |
customerservice@livchem.com | |||
| Chemical distributor | ||||
| Classification | API >> Synthetic anti-infective drugs >> Sulfonamides and synergists |
|---|---|
| Name | 4-[(4-Bromophenyl)Sulfonyl]Thiomorpholine |
| Synonyms | 1-[(4-Bromobenzene)sulfonyl]thiomorpholine; MFCD07783890; n-thiomorpholinyl 4-bromobenzenesulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12BrNO2S2 |
| Molecular Weight | 322.24 |
| CAS Registry Number | 223555-81-5 |
| SMILES | O=S(=O)(N1CCSCC1)c2ccc(Br)cc2 |
| InChI | 1S/C10H12BrNO2S2/c11-9-1-3-10(4-2-9)16(13,14)12-5-7-15-8-6-12/h1-4H,5-8H2 |
| InChIKey | MWNGGAAVBXUDBS-UHFFFAOYSA-N |
| Density | 1.608g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.836°C at 760 mmHg (Cal.) |
| Flash point | 222.224°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Bromophenyl)Sulfonyl]Thiomorpholine |