Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | cis-4-(1-Piperazinyl)Cyclohexanol |
|---|---|
| Synonyms | (1s,4s)-4-(piperazin-1-yl)cyclohexanol; cis-4-(1-Piperazinyl)cyclohexanol; cis-4-(1-Piperazinyl)cyclohexanol |
| Molecular Structure |  |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 |
| CAS Registry Number | 223605-17-2 |
| SMILES | C1[C@@H](CC[C@@H](C1)O)N2CCNCC2 |
| InChI | 1S/C10H20N2O/c13-10-3-1-9(2-4-10)12-7-5-11-6-8-12/h9-11,13H,1-8H2/t9-,10+ |
| InChIKey | XXJFHDNRNBKUIC-AOOOYVTPSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.1±37.0°C at 760 mmHg (Cal.) |
| Flash point | 140.8±26.5°C (Cal.) |
| Refractive index | 1.529 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-4-(1-Piperazinyl)Cyclohexanol |