Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,4-Dichloro-7-Isoquinolinesulfonyl Chloride |
|---|---|
| Synonyms | 1,4-Dichloro-7-isoquinolinesulfonyl Chloride; 1,4-dichloroisoquinoline-7-sulfonyl chloride |
| Molecular Structure |  |
| Molecular Formula | C9H4Cl3NO2S |
| Molecular Weight | 296.56 |
| CAS Registry Number | 223671-80-5 |
| SMILES | ClS(=O)(=O)c1ccc2c(Cl)cnc(Cl)c2c1 |
| InChI | 1S/C9H4Cl3NO2S/c10-8-4-13-9(11)7-3-5(16(12,14)15)1-2-6(7)8/h1-4H |
| InChIKey | UVTOICZCRRXFKE-UHFFFAOYSA-N |
| Density | 1.672g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.369°C at 760 mmHg (Cal.) |
| Flash point | 224.966°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dichloro-7-Isoquinolinesulfonyl Chloride |