Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-(Trifluoromethyl)-2-[(Trifluoromethyl)Sulfinyl]Thiophene |
|---|---|
| Synonyms | 4-(Trifluormethyl)-2-[(trifluormethyl)sulfinyl]thiophen; 4-(Trifluoromethyl)-2-[(trifluoromethyl)sulfinyl]thiophene; 4-(Trifluorométhyl)-2-[(trifluorométhyl)sulfinyl]thiophène |
| Molecular Structure | ![CAS#: 223683-78-1， 4-(Trifluoromethyl)-2-[(Trifluoromethyl)Sulfinyl]Thiophene](/moreStructures/223683-78-1.gif) |
| Molecular Formula | C6H2F6OS2 |
| Molecular Weight | 268.20 |
| CAS Registry Number | 223683-78-1 |
| SMILES | c1c(csc1S(=O)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C6H2F6OS2/c7-5(8,9)3-1-4(14-2-3)15(13)6(10,11)12/h1-2H |
| InChIKey | VPYCSOLVNCBBHK-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.2±40.0°C at 760 mmHg (Cal.) |
| Flash point | 95.5±27.3°C (Cal.) |
| Refractive index | 1.476 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Trifluoromethyl)-2-[(Trifluoromethyl)Sulfinyl]Thiophene |