Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 9-Ethoxypyrido[3',4':4,5]Furo[3,2-b]Pyridine |
|---|---|
| Synonyms | 9-ethoxyfuro[3,2-b:4,5-c']dipyridine |
| Molecular Structure | ![CAS#: 223693-35-4， 9-Ethoxypyrido[3',4':4,5]Furo[3,2-b]Pyridine](/moreStructures/223693-35-4.gif) |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 223693-35-4 |
| SMILES | n1cccc2oc3c(c12)c(OCC)ncc3 |
| InChI | 1S/C12H10N2O2/c1-2-15-12-10-8(5-7-14-12)16-9-4-3-6-13-11(9)10/h3-7H,2H2,1H3 |
| InChIKey | NVCXNYLWJRZYJI-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.903°C at 760 mmHg (Cal.) |
| Flash point | 169.649°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Ethoxypyrido[3',4':4,5]Furo[3,2-b]Pyridine |