|
CAS#: 22426-24-0 Product: DL-1-(2-Furyl)Ethyl Acetate No suppilers available for the product. |
| Name | DL-1-(2-Furyl)Ethyl Acetate |
|---|---|
| Synonyms | [(1R)-1-(2-Furyl)Ethyl] Acetate; Acetic Acid [(1R)-1-(2-Furyl)Ethyl] Ester; [(1R)-1-Furan-2-Ylethyl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.17 |
| CAS Registry Number | 22426-24-0 |
| SMILES | [C@@H](C1=CC=CO1)(OC(=O)C)C |
| InChI | 1S/C8H10O3/c1-6(11-7(2)9)8-4-3-5-10-8/h3-6H,1-2H3/t6-/m1/s1 |
| InChIKey | WOYASPSVTWXGJJ-ZCFIWIBFSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 153.675°C at 760 mmHg (Cal.) |
| Flash point | 63.84°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for DL-1-(2-Furyl)Ethyl Acetate |