Online Database of Chemicals from Around the World
|
CAS#: 22439-22-1 Product: Dichlorobis(Methylsulfonyl)Methane No suppilers available for the product. |
| Name | Dichlorobis(Methylsulfonyl)Methane |
|---|---|
| Synonyms | (Dichloro-Methylsulfonyl-Methyl)Sulfonylmethane; (Dichloro-Mesyl-Methyl)Sulfonylmethane; Brn 1785334 |
| Molecular Structure |  |
| Molecular Formula | C3H6Cl2O4S2 |
| Molecular Weight | 241.10 |
| CAS Registry Number | 22439-22-1 |
| SMILES | C[S](=O)(=O)C([S](=O)(=O)C)(Cl)Cl |
| InChI | 1S/C3H6Cl2O4S2/c1-10(6,7)3(4,5)11(2,8)9/h1-2H3 |
| InChIKey | PORPUUUZTQOYIA-UHFFFAOYSA-N |
| Density | 1.687g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.325°C at 760 mmHg (Cal.) |
| Flash point | 197.724°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichlorobis(Methylsulfonyl)Methane |